C13H14N4O4S2 — CID 144893339
2-sulfamoyl-6-(4-sulfamoylphenyl)benzenecarboximidamide (PubChem CID 144893339) has the molecular formula C13H14N4O4S2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-sulfamoyl-6-(4-sulfamoylphenyl)benzenecarboximidamide.
| Compound Name | 2-sulfamoyl-6-(4-sulfamoylphenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 144893339 |
| Molecular Formula | C13H14N4O4S2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 2-sulfamoyl-6-(4-sulfamoylphenyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(-c2ccc(S(N)(=O)=O)cc2)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C13H14N4O4S2/c14-13(15)12-10(2-1-3-11(12)23(17,20)21)8-4-6-9(7-5-8)22(16,18)19/h1-7H,(H3,14,15)(H2,16,18,19)(H2,17,20,21) |
| InChIKey | RCBHCIWTGHXTGQ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 170.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|