C18H23N5O5S — CID 144893555
(2S,3R)-2-[[4-[2-[(Z)-C-aminocarbonohydrazonoyl]-3-sulfamoylphenyl]phenyl]methylamino]-3-hydroxybutanoic acid (PubChem CID 144893555) has the molecular formula C18H23N5O5S and a molecular weight of 421.48 g/mol. Its IUPAC name is (2S,3R)-2-[[4-[2-[(Z)-C-aminocarbonohydrazonoyl]-3-sulfamoylphenyl]phenyl]methylamino]-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-[[4-[2-[(Z)-C-aminocarbonohydrazonoyl]-3-sulfamoylphenyl]phenyl]methylamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 144893555 |
| Molecular Formula | C18H23N5O5S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | (2S,3R)-2-[[4-[2-[(Z)-C-aminocarbonohydrazonoyl]-3-sulfamoylphenyl]phenyl]methylamino]-3-hydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@H](NCc1ccc(-c2cccc(S(N)(=O)=O)c2/C(N)=N/N)cc1)C(=O)O |
| InChI | InChI=1S/C18H23N5O5S/c1-10(24)16(18(25)26)22-9-11-5-7-12(8-6-11)13-3-2-4-14(29(21,27)28)15(13)17(19)23-20/h2-8,10,16,22,24H,9,20H2,1H3,(H2,19,23)(H,25,26)(H2,21,27,28)/t10-,16+/m1/s1 |
| InChIKey | NPQQBINXEIRQMU-HWPZZCPQSA-N |
| XLogP | -0.50 |
| TPSA | 194.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|