C18H22N2O8S — CID 88770479
(2S)-3-hydroxy-2-[(4-nitrophenyl)methylamino]butanoic acid;4-methylbenzenesulfonic acid (PubChem CID 88770479) has the molecular formula C18H22N2O8S and a molecular weight of 426.45 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[(4-nitrophenyl)methylamino]butanoic acid;4-methylbenzenesulfonic acid.
| Compound Name | (2S)-3-hydroxy-2-[(4-nitrophenyl)methylamino]butanoic acid;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 88770479 |
| Molecular Formula | C18H22N2O8S |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | (2S)-3-hydroxy-2-[(4-nitrophenyl)methylamino]butanoic acid;4-methylbenzenesulfonic acid |
| SMILES | CC(O)[C@H](NCc1ccc([N+](=O)[O-])cc1)C(=O)O.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C11H14N2O5.C7H8O3S/c1-7(14)10(11(15)16)12-6-8-2-4-9(5-3-8)13(17)18;1-6-2-4-7(5-3-6)11(8,9)10/h2-5,7,10,12,14H,6H2,1H3,(H,15,16);2-5H,1H3,(H,8,9,10)/t7?,10-;/m0./s1 |
| InChIKey | MNCNVLPCKSCRPN-QPQWKYTISA-N |
| XLogP | 1.76 |
| TPSA | 167.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|