C25H37N3O9S — CID 158841372
(2S)-2-amino-3-methylbutanoic acid;4-methylbenzenesulfonic acid;(4-nitrophenyl)methyl (2R,3R)-2-amino-3-methylpentanoate (PubChem CID 158841372) has the molecular formula C25H37N3O9S and a molecular weight of 555.65 g/mol. Its IUPAC name is (2S)-2-amino-3-methylbutanoic acid;4-methylbenzenesulfonic acid;(4-nitrophenyl)methyl (2R,3R)-2-amino-3-methylpentanoate.
| Compound Name | (2S)-2-amino-3-methylbutanoic acid;4-methylbenzenesulfonic acid;(4-nitrophenyl)methyl (2R,3R)-2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 158841372 |
| Molecular Formula | C25H37N3O9S |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | (2S)-2-amino-3-methylbutanoic acid;4-methylbenzenesulfonic acid;(4-nitrophenyl)methyl (2R,3R)-2-amino-3-methylpentanoate |
| SMILES | CC(C)[C@H](N)C(=O)O.CC[C@@H](C)[C@@H](N)C(=O)OCc1ccc([N+](=O)[O-])cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C13H18N2O4.C7H8O3S.C5H11NO2/c1-3-9(2)12(14)13(16)19-8-10-4-6-11(7-5-10)15(17)18;1-6-2-4-7(5-3-6)11(8,9)10;1-3(2)4(6)5(7)8/h4-7,9,12H,3,8,14H2,1-2H3;2-5H,1H3,(H,8,9,10);3-4H,6H2,1-2H3,(H,7,8)/t9-,12-;;4-/m1.0/s1 |
| InChIKey | IYHBDMIEVHQBBX-IFXIFENWSA-N |
| XLogP | 3.31 |
| TPSA | 213.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|