C18H20F2N6O2S — CID 172953180
N'-diazenyl-2-[4-[[(3,3-difluorocyclobutyl)amino]methyl]phenyl]-6-sulfamoylbenzenecarboximidamide (PubChem CID 172953180) has the molecular formula C18H20F2N6O2S and a molecular weight of 422.46 g/mol. Its IUPAC name is N'-diazenyl-2-[4-[[(3,3-difluorocyclobutyl)amino]methyl]phenyl]-6-sulfamoylbenzenecarboximidamide.
| Compound Name | N'-diazenyl-2-[4-[[(3,3-difluorocyclobutyl)amino]methyl]phenyl]-6-sulfamoylbenzenecarboximidamide |
|---|---|
| PubChem CID | 172953180 |
| Molecular Formula | C18H20F2N6O2S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | N'-diazenyl-2-[4-[[(3,3-difluorocyclobutyl)amino]methyl]phenyl]-6-sulfamoylbenzenecarboximidamide |
| SMILES | [H]/N=N/N=C(\N)c1c(-c2ccc(CNC3CC(F)(F)C3)cc2)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C18H20F2N6O2S/c19-18(20)8-13(9-18)24-10-11-4-6-12(7-5-11)14-2-1-3-15(29(23,27)28)16(14)17(21)25-26-22/h1-7,13,24H,8-10H2,(H3,21,22,25)(H2,23,27,28) |
| InChIKey | WTLOWBJHNBUHMY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 146.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|