C16H17N3O3S — CID 144893602
2-(3,4-dihydro-2H-chromen-6-yl)-6-sulfamoylbenzenecarboximidamide (PubChem CID 144893602) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-6-yl)-6-sulfamoylbenzenecarboximidamide.
| Compound Name | 2-(3,4-dihydro-2H-chromen-6-yl)-6-sulfamoylbenzenecarboximidamide |
|---|---|
| PubChem CID | 144893602 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-(3,4-dihydro-2H-chromen-6-yl)-6-sulfamoylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(-c2ccc3c(c2)CCCO3)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C16H17N3O3S/c17-16(18)15-12(4-1-5-14(15)23(19,20)21)10-6-7-13-11(9-10)3-2-8-22-13/h1,4-7,9H,2-3,8H2,(H3,17,18)(H2,19,20,21) |
| InChIKey | HCPRVIVWEYJSSB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 119.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|