C26H26N4O4S — CID 142166754
3-[(E)-2-methyl-3-oxo-4-[7-(2-sulfamoylphenyl)-2,3-dihydro-1,4-benzoxazin-4-yl]but-1-enyl]benzenecarboximidamide (PubChem CID 142166754) has the molecular formula C26H26N4O4S and a molecular weight of 490.59 g/mol. Its IUPAC name is 3-[(E)-2-methyl-3-oxo-4-[7-(2-sulfamoylphenyl)-2,3-dihydro-1,4-benzoxazin-4-yl]but-1-enyl]benzenecarboximidamide.
| Compound Name | 3-[(E)-2-methyl-3-oxo-4-[7-(2-sulfamoylphenyl)-2,3-dihydro-1,4-benzoxazin-4-yl]but-1-enyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 142166754 |
| Molecular Formula | C26H26N4O4S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 3-[(E)-2-methyl-3-oxo-4-[7-(2-sulfamoylphenyl)-2,3-dihydro-1,4-benzoxazin-4-yl]but-1-enyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(/C=C(\C)C(=O)CN2CCOc3cc(-c4ccccc4S(N)(=O)=O)ccc32)c1 |
| InChI | InChI=1S/C26H26N4O4S/c1-17(13-18-5-4-6-20(14-18)26(27)28)23(31)16-30-11-12-34-24-15-19(9-10-22(24)30)21-7-2-3-8-25(21)35(29,32)33/h2-10,13-15H,11-12,16H2,1H3,(H3,27,28)(H2,29,32,33)/b17-13+ |
| InChIKey | XANCGOUJDALFPJ-GHRIWEEISA-N |
| XLogP | 3.16 |
| TPSA | 139.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|