C26H23N5O3S2 — CID 22980849
3-[2-methyl-5-[5-(2-sulfamoylphenyl)-2,3-dihydroindole-1-carbonyl]-1,3-thiazol-4-yl]benzenecarboximidamide (PubChem CID 22980849) has the molecular formula C26H23N5O3S2 and a molecular weight of 517.64 g/mol. Its IUPAC name is 3-[2-methyl-5-[5-(2-sulfamoylphenyl)-2,3-dihydroindole-1-carbonyl]-1,3-thiazol-4-yl]benzenecarboximidamide.
| Compound Name | 3-[2-methyl-5-[5-(2-sulfamoylphenyl)-2,3-dihydroindole-1-carbonyl]-1,3-thiazol-4-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 22980849 |
| Molecular Formula | C26H23N5O3S2 |
| Molecular Weight | 517.64 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | 3-[2-methyl-5-[5-(2-sulfamoylphenyl)-2,3-dihydroindole-1-carbonyl]-1,3-thiazol-4-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(-c2nc(C)sc2C(=O)N2CCc3cc(-c4ccccc4S(N)(=O)=O)ccc32)c1 |
| InChI | InChI=1S/C26H23N5O3S2/c1-15-30-23(18-5-4-6-19(14-18)25(27)28)24(35-15)26(32)31-12-11-17-13-16(9-10-21(17)31)20-7-2-3-8-22(20)36(29,33)34/h2-10,13-14H,11-12H2,1H3,(H3,27,28)(H2,29,33,34) |
| InChIKey | YNRUYAXMGBDSLA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 143.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.64 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|