C13H13F3OS — CID 123528445
(E)-6-[3-(trifluoromethyl)phenyl]sulfanylhex-4-en-2-one (PubChem CID 123528445) has the molecular formula C13H13F3OS and a molecular weight of 274.31 g/mol. Its IUPAC name is (E)-6-[3-(trifluoromethyl)phenyl]sulfanylhex-4-en-2-one.
| Compound Name | (E)-6-[3-(trifluoromethyl)phenyl]sulfanylhex-4-en-2-one |
|---|---|
| PubChem CID | 123528445 |
| Molecular Formula | C13H13F3OS |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | (E)-6-[3-(trifluoromethyl)phenyl]sulfanylhex-4-en-2-one |
| SMILES | CC(=O)C/C=C/CSc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F3OS/c1-10(17)5-2-3-8-18-12-7-4-6-11(9-12)13(14,15)16/h2-4,6-7,9H,5,8H2,1H3/b3-2+ |
| InChIKey | QBSSYBUQNLVGDX-NSCUHMNNSA-N |
| XLogP | 4.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|