C12H17NO — CID 123528540
4-piperidin-1-ylcyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 123528540) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 4-piperidin-1-ylcyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | 4-piperidin-1-ylcyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 123528540 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 4-piperidin-1-ylcyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | O=CC1=CC=C(N2CCCCC2)CC1 |
| InChI | InChI=1S/C12H17NO/c14-10-11-4-6-12(7-5-11)13-8-2-1-3-9-13/h4,6,10H,1-3,5,7-9H2 |
| InChIKey | OBGOEZRREICHKE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|