C17H27NO5 — CID 123715072
4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)cyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 123715072) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is 4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)cyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | 4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)cyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 123715072 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)cyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | O=CC1=CC=C(N2CCOCCOCCOCCOCC2)CC1 |
| InChI | InChI=1S/C17H27NO5/c19-15-16-1-3-17(4-2-16)18-5-7-20-9-11-22-13-14-23-12-10-21-8-6-18/h1,3,15H,2,4-14H2 |
| InChIKey | RJPQLQJIIYJLHV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|