About 4-(4,4-difluorocyclohexen-1-yl)morpholine
4-(4,4-difluorocyclohexen-1-yl)morpholine (PubChem CID 70937775) has the molecular formula C10H15F2NO
and a molecular weight of 203.23 g/mol. Its IUPAC name is 4-(4,4-difluorocyclohexen-1-yl)morpholine.
Molecular Properties
| Compound Name | 4-(4,4-difluorocyclohexen-1-yl)morpholine |
| PubChem CID | 70937775 |
| Molecular Formula | C10H15F2NO |
| Molecular Weight | 203.23 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 4-(4,4-difluorocyclohexen-1-yl)morpholine |
| SMILES | FC1(F)CC=C(N2CCOCC2)CC1 |
| InChI | InChI=1S/C10H15F2NO/c11-10(12)3-1-9(2-4-10)13-5-7-14-8-6-13/h1H,2-8H2 |
| InChIKey | CFUPEYMETUZYCD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.23 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4,4-difluorocyclohexen-1-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-difluorocyclohexen-1-yl)morpholine?
The IUPAC name of 4-(4,4-difluorocyclohexen-1-yl)morpholine (CID 70937775) is 4-(4,4-difluorocyclohexen-1-yl)morpholine.
What is the SMILES notation for 4-(4,4-difluorocyclohexen-1-yl)morpholine?
The canonical SMILES for 4-(4,4-difluorocyclohexen-1-yl)morpholine is FC1(F)CC=C(N2CCOCC2)CC1.
What is the InChIKey of 4-(4,4-difluorocyclohexen-1-yl)morpholine?
The InChIKey is CFUPEYMETUZYCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F2NO/c11-10(12)3-1-9(2-4-10)13-5-7-14-8-6-13/h1H,2-8H2.
What are the key properties of 4-(4,4-difluorocyclohexen-1-yl)morpholine?
4-(4,4-difluorocyclohexen-1-yl)morpholine has a molecular weight of 203.23 g/mol, XLogP of 2.02, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-difluorocyclohexen-1-yl)morpholine is sourced from PubChem (CID 70937775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).