C10H16N2O — CID 89307922
4-morpholin-4-ylcyclohexa-1,3-dien-1-amine (PubChem CID 89307922) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-morpholin-4-ylcyclohexa-1,3-dien-1-amine.
| Compound Name | 4-morpholin-4-ylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 89307922 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 4-morpholin-4-ylcyclohexa-1,3-dien-1-amine |
| SMILES | NC1=CC=C(N2CCOCC2)CC1 |
| InChI | InChI=1S/C10H16N2O/c11-9-1-3-10(4-2-9)12-5-7-13-8-6-12/h1,3H,2,4-8,11H2 |
| InChIKey | AFWMUIJNCBSBHG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |