C14H12N2O2 — CID 142967069
2-(4-aminocyclohexa-1,3-dien-1-yl)isoindole-1,3-dione (PubChem CID 142967069) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-(4-aminocyclohexa-1,3-dien-1-yl)isoindole-1,3-dione.
| Compound Name | 2-(4-aminocyclohexa-1,3-dien-1-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 142967069 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 2-(4-aminocyclohexa-1,3-dien-1-yl)isoindole-1,3-dione |
| SMILES | NC1=CC=C(N2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C14H12N2O2/c15-9-5-7-10(8-6-9)16-13(17)11-3-1-2-4-12(11)14(16)18/h1-5,7H,6,8,15H2 |
| InChIKey | XVQDZBUGJQKWNZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|