C12H9N5O2 — CID 100984720
2-(2,6-diaminopyrimidin-4-yl)isoindole-1,3-dione (PubChem CID 100984720) has the molecular formula C12H9N5O2 and a molecular weight of 255.24 g/mol. Its IUPAC name is 2-(2,6-diaminopyrimidin-4-yl)isoindole-1,3-dione.
| Compound Name | 2-(2,6-diaminopyrimidin-4-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 100984720 |
| Molecular Formula | C12H9N5O2 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2-(2,6-diaminopyrimidin-4-yl)isoindole-1,3-dione |
| SMILES | Nc1cc(N2C(=O)c3ccccc3C2=O)nc(N)n1 |
| InChI | InChI=1S/C12H9N5O2/c13-8-5-9(16-12(14)15-8)17-10(18)6-3-1-2-4-7(6)11(17)19/h1-5H,(H4,13,14,15,16) |
| InChIKey | IMMLNQHXPFTTKG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 115.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|