C9H15N3O — CID 144865610
4-(6-methyl-1,2-dihydropyridazin-3-yl)morpholine (PubChem CID 144865610) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 4-(6-methyl-1,2-dihydropyridazin-3-yl)morpholine.
| Compound Name | 4-(6-methyl-1,2-dihydropyridazin-3-yl)morpholine |
|---|---|
| PubChem CID | 144865610 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 4-(6-methyl-1,2-dihydropyridazin-3-yl)morpholine |
| SMILES | CC1=CC=C(N2CCOCC2)NN1 |
| InChI | InChI=1S/C9H15N3O/c1-8-2-3-9(11-10-8)12-4-6-13-7-5-12/h2-3,10-11H,4-7H2,1H3 |
| InChIKey | DWLABLMUSWUPLW-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |