C11H17F2NO — CID 168976100
4-[(4,4-difluorocyclohexylidene)methyl]morpholine (PubChem CID 168976100) has the molecular formula C11H17F2NO and a molecular weight of 217.26 g/mol. Its IUPAC name is 4-[(4,4-difluorocyclohexylidene)methyl]morpholine.
| Compound Name | 4-[(4,4-difluorocyclohexylidene)methyl]morpholine |
|---|---|
| PubChem CID | 168976100 |
| Molecular Formula | C11H17F2NO |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 4-[(4,4-difluorocyclohexylidene)methyl]morpholine |
| SMILES | FC1(F)CCC(=CN2CCOCC2)CC1 |
| InChI | InChI=1S/C11H17F2NO/c12-11(13)3-1-10(2-4-11)9-14-5-7-15-8-6-14/h9H,1-8H2 |
| InChIKey | SYEKOQXHXPVRQL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |