C8H10N2O3 — CID 96628098
5-morpholin-4-yl-1,2-oxazole-3-carbaldehyde (PubChem CID 96628098) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is 5-morpholin-4-yl-1,2-oxazole-3-carbaldehyde.
| Compound Name | 5-morpholin-4-yl-1,2-oxazole-3-carbaldehyde |
|---|---|
| PubChem CID | 96628098 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 5-morpholin-4-yl-1,2-oxazole-3-carbaldehyde |
| SMILES | O=Cc1cc(N2CCOCC2)on1 |
| InChI | InChI=1S/C8H10N2O3/c11-6-7-5-8(13-9-7)10-1-3-12-4-2-10/h5-6H,1-4H2 |
| InChIKey | HHGPEKCBHQCFKY-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|