C7H11N3O — CID 112711331
5-pyrrolidin-1-yl-1,2-oxazol-3-amine (PubChem CID 112711331) has the molecular formula C7H11N3O and a molecular weight of 153.19 g/mol. Its IUPAC name is 5-pyrrolidin-1-yl-1,2-oxazol-3-amine.
| Compound Name | 5-pyrrolidin-1-yl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 112711331 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 5-pyrrolidin-1-yl-1,2-oxazol-3-amine |
| SMILES | Nc1cc(N2CCCC2)on1 |
| InChI | InChI=1S/C7H11N3O/c8-6-5-7(11-9-6)10-3-1-2-4-10/h5H,1-4H2,(H2,8,9) |
| InChIKey | PLULVMDUGPPUAC-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |