C30H27N — CID 123528548
N-(3,3-dimethylfluoren-9-yl)-6,6-dimethyl-8aH-fluoren-9-imine (PubChem CID 123528548) has the molecular formula C30H27N and a molecular weight of 401.55 g/mol. Its IUPAC name is N-(3,3-dimethylfluoren-9-yl)-6,6-dimethyl-8aH-fluoren-9-imine.
| Compound Name | N-(3,3-dimethylfluoren-9-yl)-6,6-dimethyl-8aH-fluoren-9-imine |
|---|---|
| PubChem CID | 123528548 |
| Molecular Formula | C30H27N |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | N-(3,3-dimethylfluoren-9-yl)-6,6-dimethyl-8aH-fluoren-9-imine |
| SMILES | CC1(C)C=CC2=C(/N=C3\c4ccccc4C4=CC(C)(C)C=CC43)c3ccccc3C2=C1 |
| InChI | InChI=1S/C30H27N/c1-29(2)15-13-23-25(17-29)19-9-5-7-11-21(19)27(23)31-28-22-12-8-6-10-20(22)26-18-30(3,4)16-14-24(26)28/h5-18,23H,1-4H3/b31-27+ |
| InChIKey | HOUXLEFVMVEGJJ-TVKQRKNISA-N |
| XLogP | 7.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|