C27H31N8OP — CID 123529320
4-[4-(5-benzylpyrimidin-2-yl)-3-methylpiperazin-1-yl]-N-(4-dimethylphosphorylphenyl)-1,3,5-triazin-2-amine (PubChem CID 123529320) has the molecular formula C27H31N8OP and a molecular weight of 514.57 g/mol. Its IUPAC name is 4-[4-(5-benzylpyrimidin-2-yl)-3-methylpiperazin-1-yl]-N-(4-dimethylphosphorylphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-[4-(5-benzylpyrimidin-2-yl)-3-methylpiperazin-1-yl]-N-(4-dimethylphosphorylphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 123529320 |
| Molecular Formula | C27H31N8OP |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 4-[4-(5-benzylpyrimidin-2-yl)-3-methylpiperazin-1-yl]-N-(4-dimethylphosphorylphenyl)-1,3,5-triazin-2-amine |
| SMILES | CC1CN(c2ncnc(Nc3ccc(P(C)(C)=O)cc3)n2)CCN1c1ncc(Cc2ccccc2)cn1 |
| InChI | InChI=1S/C27H31N8OP/c1-20-18-34(13-14-35(20)26-28-16-22(17-29-26)15-21-7-5-4-6-8-21)27-31-19-30-25(33-27)32-23-9-11-24(12-10-23)37(2,3)36/h4-12,16-17,19-20H,13-15,18H2,1-3H3,(H,30,31,32,33) |
| InChIKey | JLPSQWVQZHWSAQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|