C30H36N10 — CID 147111398
4-[4-(4-amino-5-benzylpyrimidin-2-yl)piperazin-1-yl]-N-[4-(azepan-1-yl)phenyl]-1,3,5-triazin-2-amine (PubChem CID 147111398) has the molecular formula C30H36N10 and a molecular weight of 536.69 g/mol. Its IUPAC name is 4-[4-(4-amino-5-benzylpyrimidin-2-yl)piperazin-1-yl]-N-[4-(azepan-1-yl)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-[4-(4-amino-5-benzylpyrimidin-2-yl)piperazin-1-yl]-N-[4-(azepan-1-yl)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 147111398 |
| Molecular Formula | C30H36N10 |
| Molecular Weight | 536.69 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | 4-[4-(4-amino-5-benzylpyrimidin-2-yl)piperazin-1-yl]-N-[4-(azepan-1-yl)phenyl]-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(N2CCN(c3ncnc(Nc4ccc(N5CCCCCC5)cc4)n3)CC2)ncc1Cc1ccccc1 |
| InChI | InChI=1S/C30H36N10/c31-27-24(20-23-8-4-3-5-9-23)21-32-29(36-27)39-16-18-40(19-17-39)30-34-22-33-28(37-30)35-25-10-12-26(13-11-25)38-14-6-1-2-7-15-38/h3-5,8-13,21-22H,1-2,6-7,14-20H2,(H2,31,32,36)(H,33,34,35,37) |
| InChIKey | BMOQJOYHRUDLRF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.69 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|