C29H34N10O — CID 118031505
(3R)-1-[4-[[4-[4-(4-amino-5-benzylpyrimidin-2-yl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]piperidin-3-ol (PubChem CID 118031505) has the molecular formula C29H34N10O and a molecular weight of 538.66 g/mol. Its IUPAC name is (3R)-1-[4-[[4-[4-(4-amino-5-benzylpyrimidin-2-yl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]piperidin-3-ol.
| Compound Name | (3R)-1-[4-[[4-[4-(4-amino-5-benzylpyrimidin-2-yl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]piperidin-3-ol |
|---|---|
| PubChem CID | 118031505 |
| Molecular Formula | C29H34N10O |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | (3R)-1-[4-[[4-[4-(4-amino-5-benzylpyrimidin-2-yl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]piperidin-3-ol |
| SMILES | Nc1nc(N2CCN(c3ncnc(Nc4ccc(N5CCC[C@@H](O)C5)cc4)n3)CC2)ncc1Cc1ccccc1 |
| InChI | InChI=1S/C29H34N10O/c30-26-22(17-21-5-2-1-3-6-21)18-31-28(35-26)37-13-15-38(16-14-37)29-33-20-32-27(36-29)34-23-8-10-24(11-9-23)39-12-4-7-25(40)19-39/h1-3,5-6,8-11,18,20,25,40H,4,7,12-17,19H2,(H2,30,31,35)(H,32,33,34,36)/t25-/m1/s1 |
| InChIKey | ZAKULFDDWSWSQI-RUZDIDTESA-N |
| XLogP | 2.87 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|