C28H31N9O — CID 123415301
1-[4-[[4-[4-(5-benzylpyrimidin-2-yl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]pyrrolidin-3-ol (PubChem CID 123415301) has the molecular formula C28H31N9O and a molecular weight of 509.62 g/mol. Its IUPAC name is 1-[4-[[4-[4-(5-benzylpyrimidin-2-yl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]pyrrolidin-3-ol.
| Compound Name | 1-[4-[[4-[4-(5-benzylpyrimidin-2-yl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 123415301 |
| Molecular Formula | C28H31N9O |
| Molecular Weight | 509.62 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | 1-[4-[[4-[4-(5-benzylpyrimidin-2-yl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]pyrrolidin-3-ol |
| SMILES | OC1CCN(c2ccc(Nc3ncnc(N4CCN(c5ncc(Cc6ccccc6)cn5)CC4)n3)cc2)C1 |
| InChI | InChI=1S/C28H31N9O/c38-25-10-11-37(19-25)24-8-6-23(7-9-24)33-26-31-20-32-28(34-26)36-14-12-35(13-15-36)27-29-17-22(18-30-27)16-21-4-2-1-3-5-21/h1-9,17-18,20,25,38H,10-16,19H2,(H,31,32,33,34) |
| InChIKey | LULOBEQQQASSAL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.62 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|