C26H33N9O — CID 118034430
(3R)-1-[4-[[4-[4-(5-but-3-enylpyrimidin-2-yl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]piperidin-3-ol (PubChem CID 118034430) has the molecular formula C26H33N9O and a molecular weight of 487.61 g/mol. Its IUPAC name is (3R)-1-[4-[[4-[4-(5-but-3-enylpyrimidin-2-yl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]piperidin-3-ol.
| Compound Name | (3R)-1-[4-[[4-[4-(5-but-3-enylpyrimidin-2-yl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]piperidin-3-ol |
|---|---|
| PubChem CID | 118034430 |
| Molecular Formula | C26H33N9O |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | (3R)-1-[4-[[4-[4-(5-but-3-enylpyrimidin-2-yl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]piperidin-3-ol |
| SMILES | C=CCCc1cnc(N2CCN(c3ncnc(Nc4ccc(N5CCC[C@@H](O)C5)cc4)n3)CC2)nc1 |
| InChI | InChI=1S/C26H33N9O/c1-2-3-5-20-16-27-25(28-17-20)33-12-14-34(15-13-33)26-30-19-29-24(32-26)31-21-7-9-22(10-8-21)35-11-4-6-23(36)18-35/h2,7-10,16-17,19,23,36H,1,3-6,11-15,18H2,(H,29,30,31,32)/t23-/m1/s1 |
| InChIKey | VIKYFVRMDSNYSY-HSZRJFAPSA-N |
| XLogP | 2.81 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|