C30H35N9O — CID 123753030
1-[4-[[4-[4-[5-(1-phenylethyl)pyrimidin-2-yl]piperazin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]piperidin-3-ol (PubChem CID 123753030) has the molecular formula C30H35N9O and a molecular weight of 537.67 g/mol. Its IUPAC name is 1-[4-[[4-[4-[5-(1-phenylethyl)pyrimidin-2-yl]piperazin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]piperidin-3-ol.
| Compound Name | 1-[4-[[4-[4-[5-(1-phenylethyl)pyrimidin-2-yl]piperazin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]piperidin-3-ol |
|---|---|
| PubChem CID | 123753030 |
| Molecular Formula | C30H35N9O |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | 1-[4-[[4-[4-[5-(1-phenylethyl)pyrimidin-2-yl]piperazin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]piperidin-3-ol |
| SMILES | CC(c1ccccc1)c1cnc(N2CCN(c3ncnc(Nc4ccc(N5CCCC(O)C5)cc4)n3)CC2)nc1 |
| InChI | InChI=1S/C30H35N9O/c1-22(23-6-3-2-4-7-23)24-18-31-29(32-19-24)37-14-16-38(17-15-37)30-34-21-33-28(36-30)35-25-9-11-26(12-10-25)39-13-5-8-27(40)20-39/h2-4,6-7,9-12,18-19,21-22,27,40H,5,8,13-17,20H2,1H3,(H,33,34,35,36) |
| InChIKey | XKXYJZXBDAAMKX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|