C24H24ClN2O4S+ — CID 123532262
4-[[1-(1-benzothiophene-3-carbonyl)-1-(3-chlorophenyl)-2-methylazetidin-1-ium-2-carbonyl]amino]butanoic acid (PubChem CID 123532262) has the molecular formula C24H24ClN2O4S+ and a molecular weight of 471.99 g/mol. Its IUPAC name is 4-[[1-(1-benzothiophene-3-carbonyl)-1-(3-chlorophenyl)-2-methylazetidin-1-ium-2-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[1-(1-benzothiophene-3-carbonyl)-1-(3-chlorophenyl)-2-methylazetidin-1-ium-2-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 123532262 |
| Molecular Formula | C24H24ClN2O4S+ |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 4-[[1-(1-benzothiophene-3-carbonyl)-1-(3-chlorophenyl)-2-methylazetidin-1-ium-2-carbonyl]amino]butanoic acid |
| SMILES | CC1(C(=O)NCCCC(=O)O)CC[N+]1(C(=O)c1csc2ccccc12)c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H23ClN2O4S/c1-24(23(31)26-12-5-10-21(28)29)11-13-27(24,17-7-4-6-16(25)14-17)22(30)19-15-32-20-9-3-2-8-18(19)20/h2-4,6-9,14-15H,5,10-13H2,1H3,(H-,26,28,29,31)/p+1 |
| InChIKey | SMJMJPYWCVUXRX-UHFFFAOYSA-O |
| XLogP | 4.85 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|