C23H22ClN3O3S — CID 123535114
3-[4-[(6-chloro-3-pyridinyl)methyl]-2,2-dimethyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylic acid (PubChem CID 123535114) has the molecular formula C23H22ClN3O3S and a molecular weight of 455.97 g/mol. Its IUPAC name is 3-[4-[(6-chloro-3-pyridinyl)methyl]-2,2-dimethyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylic acid.
| Compound Name | 3-[4-[(6-chloro-3-pyridinyl)methyl]-2,2-dimethyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 123535114 |
| Molecular Formula | C23H22ClN3O3S |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 3-[4-[(6-chloro-3-pyridinyl)methyl]-2,2-dimethyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylic acid |
| SMILES | CC1(C)CN(Cc2ccc(Cl)nc2)CC(=O)N1c1cc(-c2ccccc2)sc1C(=O)O |
| InChI | InChI=1S/C23H22ClN3O3S/c1-23(2)14-26(12-15-8-9-19(24)25-11-15)13-20(28)27(23)17-10-18(31-21(17)22(29)30)16-6-4-3-5-7-16/h3-11H,12-14H2,1-2H3,(H,29,30) |
| InChIKey | QYAOJUJJQLZOEK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|