C12H21N — CID 123535412
6-isocyano-2,6,7-trimethyloct-2-ene (PubChem CID 123535412) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 6-isocyano-2,6,7-trimethyloct-2-ene.
| Compound Name | 6-isocyano-2,6,7-trimethyloct-2-ene |
|---|---|
| PubChem CID | 123535412 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 6-isocyano-2,6,7-trimethyloct-2-ene |
| SMILES | [C-]#[N+]C(C)(CCC=C(C)C)C(C)C |
| InChI | InChI=1S/C12H21N/c1-10(2)8-7-9-12(5,13-6)11(3)4/h8,11H,7,9H2,1-5H3 |
| InChIKey | CWHAWBVFXLFTOL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|