C13H24N2 — CID 123537710
N-butyl-3-methyl-N-propyl-3,4-dihydropyridin-2-amine (PubChem CID 123537710) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is N-butyl-3-methyl-N-propyl-3,4-dihydropyridin-2-amine.
| Compound Name | N-butyl-3-methyl-N-propyl-3,4-dihydropyridin-2-amine |
|---|---|
| PubChem CID | 123537710 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N-butyl-3-methyl-N-propyl-3,4-dihydropyridin-2-amine |
| SMILES | CCCCN(CCC)C1=NC=CCC1C |
| InChI | InChI=1S/C13H24N2/c1-4-6-11-15(10-5-2)13-12(3)8-7-9-14-13/h7,9,12H,4-6,8,10-11H2,1-3H3 |
| InChIKey | JNMWSLCMXXKBSH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |