C15H12N4 — CID 123538110
3-(2,3-dihydro-1H-imidazo[4,5-b]pyridin-6-yl)quinoline (PubChem CID 123538110) has the molecular formula C15H12N4 and a molecular weight of 248.29 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-imidazo[4,5-b]pyridin-6-yl)quinoline.
| Compound Name | 3-(2,3-dihydro-1H-imidazo[4,5-b]pyridin-6-yl)quinoline |
|---|---|
| PubChem CID | 123538110 |
| Molecular Formula | C15H12N4 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 3-(2,3-dihydro-1H-imidazo[4,5-b]pyridin-6-yl)quinoline |
| SMILES | c1ccc2ncc(-c3cnc4c(c3)NCN4)cc2c1 |
| InChI | InChI=1S/C15H12N4/c1-2-4-13-10(3-1)5-11(7-16-13)12-6-14-15(17-8-12)19-9-18-14/h1-8,18H,9H2,(H,17,19) |
| InChIKey | IBXAHWZHKHMQAR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |