C5H4F3NO4S — CID 123539093
(2,5-dihydroxypyrrol-1-yl) trifluoromethanesulfinate (PubChem CID 123539093) has the molecular formula C5H4F3NO4S and a molecular weight of 231.15 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) trifluoromethanesulfinate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) trifluoromethanesulfinate |
|---|---|
| PubChem CID | 123539093 |
| Molecular Formula | C5H4F3NO4S |
| Molecular Weight | 231.15 g/mol |
| Exact Mass | 230.98 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) trifluoromethanesulfinate |
| SMILES | O=S(On1c(O)ccc1O)C(F)(F)F |
| InChI | InChI=1S/C5H4F3NO4S/c6-5(7,8)14(12)13-9-3(10)1-2-4(9)11/h1-2,10-11H |
| InChIKey | CPPIAKVPDHRAIB-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.15 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |