C25H32NS+ — CID 123539601
10-butyl-6,7-diethyl-6,7-dimethyl-[1]benzothiolo[2,3-a]quinolizin-5-ium (PubChem CID 123539601) has the molecular formula C25H32NS+ and a molecular weight of 378.61 g/mol. Its IUPAC name is 10-butyl-6,7-diethyl-6,7-dimethyl-[1]benzothiolo[2,3-a]quinolizin-5-ium.
| Compound Name | 10-butyl-6,7-diethyl-6,7-dimethyl-[1]benzothiolo[2,3-a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123539601 |
| Molecular Formula | C25H32NS+ |
| Molecular Weight | 378.61 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 10-butyl-6,7-diethyl-6,7-dimethyl-[1]benzothiolo[2,3-a]quinolizin-5-ium |
| SMILES | CCCCc1ccc2c3c(sc2c1)-c1cccc[n+]1C(C)(CC)C3(C)CC |
| InChI | InChI=1S/C25H32NS/c1-6-9-12-18-14-15-19-21(17-18)27-23-20-13-10-11-16-26(20)25(5,8-3)24(4,7-2)22(19)23/h10-11,13-17H,6-9,12H2,1-5H3/q+1 |
| InChIKey | FCKYBZNYSABHKR-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.61 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|