C28H45NO7 — CID 123539846
[5-[[6-[5-(3,6-dihydroxy-4,4,6-trimethyloxan-2-yl)-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate (PubChem CID 123539846) has the molecular formula C28H45NO7 and a molecular weight of 507.67 g/mol. Its IUPAC name is [5-[[6-[5-(3,6-dihydroxy-4,4,6-trimethyloxan-2-yl)-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate.
| Compound Name | [5-[[6-[5-(3,6-dihydroxy-4,4,6-trimethyloxan-2-yl)-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 123539846 |
| Molecular Formula | C28H45NO7 |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.32 |
| IUPAC Name | [5-[[6-[5-(3,6-dihydroxy-4,4,6-trimethyloxan-2-yl)-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
| SMILES | CC(=O)OC(C)C=CC(=O)NC1CC(C)C(CC=C(C)C=CC2OC(C)(O)CC(C)(C)C2O)OC1C |
| InChI | InChI=1S/C28H45NO7/c1-17(10-13-24-26(32)27(6,7)16-28(8,33)36-24)9-12-23-18(2)15-22(20(4)35-23)29-25(31)14-11-19(3)34-21(5)30/h9-11,13-14,18-20,22-24,26,32-33H,12,15-16H2,1-8H3,(H,29,31) |
| InChIKey | DOCGCOXJFWNZPH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|