C27H42ClNO8 — CID 3073119
[(2S)-5-[[(2R,3R,5S,6S)-6-[5-[(2R,3R,4S,6S)-4-(chloromethyl)-3,4,6-trihydroxy-6-methyloxan-2-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate (PubChem CID 3073119) has the molecular formula C27H42ClNO8 and a molecular weight of 544.09 g/mol. Its IUPAC name is [(2S)-5-[[(2R,3R,5S,6S)-6-[5-[(2R,3R,4S,6S)-4-(chloromethyl)-3,4,6-trihydroxy-6-methyloxan-2-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate.
| Compound Name | [(2S)-5-[[(2R,3R,5S,6S)-6-[5-[(2R,3R,4S,6S)-4-(chloromethyl)-3,4,6-trihydroxy-6-methyloxan-2-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 3073119 |
| Molecular Formula | C27H42ClNO8 |
| Molecular Weight | 544.09 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | [(2S)-5-[[(2R,3R,5S,6S)-6-[5-[(2R,3R,4S,6S)-4-(chloromethyl)-3,4,6-trihydroxy-6-methyloxan-2-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C)C=CC(=O)N[C@@H]1C[C@H](C)[C@H](CC=C(C)C=C[C@H]2O[C@](C)(O)C[C@@](O)(CCl)[C@@H]2O)O[C@@H]1C |
| InChI | InChI=1S/C27H42ClNO8/c1-16(8-11-23-25(32)27(34,15-28)14-26(6,33)37-23)7-10-22-17(2)13-21(19(4)36-22)29-24(31)12-9-18(3)35-20(5)30/h7-9,11-12,17-19,21-23,25,32-34H,10,13-15H2,1-6H3,(H,29,31)/t17-,18-,19+,21+,22-,23+,25+,26-,27+/m0/s1 |
| InChIKey | RONUKPQOBQKEHX-LNKOABNRSA-N |
| XLogP | 2.51 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.09 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|