C28H45NO8 — CID 144849141
[(Z)-5-[[(3S,6S)-6-[(2E,4E)-5-[(2R,4R,6S)-3,6-dihydroxy-4-methoxy-4,6-dimethyloxan-2-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate (PubChem CID 144849141) has the molecular formula C28H45NO8 and a molecular weight of 523.67 g/mol. Its IUPAC name is [(Z)-5-[[(3S,6S)-6-[(2E,4E)-5-[(2R,4R,6S)-3,6-dihydroxy-4-methoxy-4,6-dimethyloxan-2-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate.
| Compound Name | [(Z)-5-[[(3S,6S)-6-[(2E,4E)-5-[(2R,4R,6S)-3,6-dihydroxy-4-methoxy-4,6-dimethyloxan-2-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 144849141 |
| Molecular Formula | C28H45NO8 |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.31 |
| IUPAC Name | [(Z)-5-[[(3S,6S)-6-[(2E,4E)-5-[(2R,4R,6S)-3,6-dihydroxy-4-methoxy-4,6-dimethyloxan-2-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
| SMILES | CO[C@]1(C)C[C@@](C)(O)O[C@H](/C=C/C(C)=C/C[C@@H]2OC(C)[C@@H](NC(=O)/C=C\C(C)OC(C)=O)CC2C)C1O |
| InChI | InChI=1S/C28H45NO8/c1-17(10-13-24-26(32)27(6,34-8)16-28(7,33)37-24)9-12-23-18(2)15-22(20(4)36-23)29-25(31)14-11-19(3)35-21(5)30/h9-11,13-14,18-20,22-24,26,32-33H,12,15-16H2,1-8H3,(H,29,31)/b13-10+,14-11-,17-9+/t18?,19?,20?,22-,23-,24+,26?,27+,28-/m0/s1 |
| InChIKey | VPBLUPQXMQUBDM-LRNPGTGKSA-N |
| XLogP | 2.95 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|