C21H24N4O2 — CID 123541097
8-cyclopentyl-7-ethyl-2-(2-phenylacetyl)-5,7-dihydropteridin-6-one (PubChem CID 123541097) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 8-cyclopentyl-7-ethyl-2-(2-phenylacetyl)-5,7-dihydropteridin-6-one.
| Compound Name | 8-cyclopentyl-7-ethyl-2-(2-phenylacetyl)-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 123541097 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 8-cyclopentyl-7-ethyl-2-(2-phenylacetyl)-5,7-dihydropteridin-6-one |
| SMILES | CCC1C(=O)Nc2cnc(C(=O)Cc3ccccc3)nc2N1C1CCCC1 |
| InChI | InChI=1S/C21H24N4O2/c1-2-17-21(27)23-16-13-22-19(18(26)12-14-8-4-3-5-9-14)24-20(16)25(17)15-10-6-7-11-15/h3-5,8-9,13,15,17H,2,6-7,10-12H2,1H3,(H,23,27) |
| InChIKey | ZWQSKPIGIVRWOJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |