C19H16NS+ — CID 123542690
2,4-dimethyl-3-methylidene-12-thia-5-azoniapentacyclo[9.7.0.02,4.05,10.013,18]octadeca-1(11),5,7,9,13,15,17-heptaene (PubChem CID 123542690) has the molecular formula C19H16NS+ and a molecular weight of 290.41 g/mol. Its IUPAC name is 2,4-dimethyl-3-methylidene-12-thia-5-azoniapentacyclo[9.7.0.02,4.05,10.013,18]octadeca-1(11),5,7,9,13,15,17-heptaene.
| Compound Name | 2,4-dimethyl-3-methylidene-12-thia-5-azoniapentacyclo[9.7.0.02,4.05,10.013,18]octadeca-1(11),5,7,9,13,15,17-heptaene |
|---|---|
| PubChem CID | 123542690 |
| Molecular Formula | C19H16NS+ |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2,4-dimethyl-3-methylidene-12-thia-5-azoniapentacyclo[9.7.0.02,4.05,10.013,18]octadeca-1(11),5,7,9,13,15,17-heptaene |
| SMILES | C=C1C2(C)c3c(sc4ccccc34)-c3cccc[n+]3C12C |
| InChI | InChI=1S/C19H16NS/c1-12-18(2)16-13-8-4-5-10-15(13)21-17(16)14-9-6-7-11-20(14)19(12,18)3/h4-11H,1H2,2-3H3/q+1 |
| InChIKey | NTXCYKZZYFFUQS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|