C16H18BNO5 — CID 123544414
(5S,6S)-9-hydroxy-9-(3-phenyloxiran-2-yl)-8-oxa-1-azonia-9-boranuidatricyclo[4.3.2.01,5]undecane-7,11-dione (PubChem CID 123544414) has the molecular formula C16H18BNO5 and a molecular weight of 315.13 g/mol. Its IUPAC name is (5S,6S)-9-hydroxy-9-(3-phenyloxiran-2-yl)-8-oxa-1-azonia-9-boranuidatricyclo[4.3.2.01,5]undecane-7,11-dione.
| Compound Name | (5S,6S)-9-hydroxy-9-(3-phenyloxiran-2-yl)-8-oxa-1-azonia-9-boranuidatricyclo[4.3.2.01,5]undecane-7,11-dione |
|---|---|
| PubChem CID | 123544414 |
| Molecular Formula | C16H18BNO5 |
| Molecular Weight | 315.13 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (5S,6S)-9-hydroxy-9-(3-phenyloxiran-2-yl)-8-oxa-1-azonia-9-boranuidatricyclo[4.3.2.01,5]undecane-7,11-dione |
| SMILES | O=C1C[N+]23CCC[C@H]2[C@@H]1C(=O)O[B-]3(O)C1OC1c1ccccc1 |
| InChI | InChI=1S/C16H18BNO5/c19-12-9-18-8-4-7-11(18)13(12)16(20)23-17(18,21)15-14(22-15)10-5-2-1-3-6-10/h1-3,5-6,11,13-15,21H,4,7-9H2/t11-,13-,14?,15?,17?,18?/m0/s1 |
| InChIKey | VSEHAJTZODGEDC-RRSCFLGASA-N |
| XLogP | 0.33 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.13 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|