C40H54O7Si — CID 123544720
ethyl (3R)-4-[(2R,6S)-6-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]butyl]-4-methylideneoxan-2-yl]-3-hydroxybutanoate (PubChem CID 123544720) has the molecular formula C40H54O7Si and a molecular weight of 674.95 g/mol. Its IUPAC name is ethyl (3R)-4-[(2R,6S)-6-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]butyl]-4-methylideneoxan-2-yl]-3-hydroxybutanoate.
| Compound Name | ethyl (3R)-4-[(2R,6S)-6-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]butyl]-4-methylideneoxan-2-yl]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 123544720 |
| Molecular Formula | C40H54O7Si |
| Molecular Weight | 674.95 g/mol |
| Exact Mass | 674.36 |
| IUPAC Name | ethyl (3R)-4-[(2R,6S)-6-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]butyl]-4-methylideneoxan-2-yl]-3-hydroxybutanoate |
| SMILES | C=C1C[C@H](C[C@@H](O)CC(=O)OCC)O[C@H](C[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OCc2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C40H54O7Si/c1-7-44-39(42)27-32(41)26-35-24-30(2)25-36(47-35)28-34(45-29-31-18-20-33(43-6)21-19-31)22-23-46-48(40(3,4)5,37-14-10-8-11-15-37)38-16-12-9-13-17-38/h8-21,32,34-36,41H,2,7,22-29H2,1,3-6H3/t32-,34+,35-,36+/m1/s1 |
| InChIKey | QNPDFYHRBIXYIX-PGQTVUBTSA-N |
| XLogP | 6.75 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.95 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|