C26H41ClN3O9P — CID 123545152
2-[[1-[4-(4-chlorophenyl)-3,3-dimethylpiperidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamoylamino]propan-2-yl 2-phosphonooxypropyl carbonate (PubChem CID 123545152) has the molecular formula C26H41ClN3O9P and a molecular weight of 606.05 g/mol. Its IUPAC name is 2-[[1-[4-(4-chlorophenyl)-3,3-dimethylpiperidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamoylamino]propan-2-yl 2-phosphonooxypropyl carbonate.
| Compound Name | 2-[[1-[4-(4-chlorophenyl)-3,3-dimethylpiperidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamoylamino]propan-2-yl 2-phosphonooxypropyl carbonate |
|---|---|
| PubChem CID | 123545152 |
| Molecular Formula | C26H41ClN3O9P |
| Molecular Weight | 606.05 g/mol |
| Exact Mass | 605.23 |
| IUPAC Name | 2-[[1-[4-(4-chlorophenyl)-3,3-dimethylpiperidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamoylamino]propan-2-yl 2-phosphonooxypropyl carbonate |
| SMILES | CC(COC(=O)OC(C)(C)NC(=O)NC(C(=O)N1CCC(c2ccc(Cl)cc2)C(C)(C)C1)C(C)C)OP(=O)(O)O |
| InChI | InChI=1S/C26H41ClN3O9P/c1-16(2)21(22(31)30-13-12-20(25(4,5)15-30)18-8-10-19(27)11-9-18)28-23(32)29-26(6,7)38-24(33)37-14-17(3)39-40(34,35)36/h8-11,16-17,20-21H,12-15H2,1-7H3,(H2,28,29,32)(H2,34,35,36) |
| InChIKey | SAYFIWNEACYEGF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 163.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.05 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|