C11H14O4S — CID 123545492
ethyl 2-cyclohepta-1,4,6-trien-1-ylsulfonylacetate (PubChem CID 123545492) has the molecular formula C11H14O4S and a molecular weight of 242.30 g/mol. Its IUPAC name is ethyl 2-cyclohepta-1,4,6-trien-1-ylsulfonylacetate.
| Compound Name | ethyl 2-cyclohepta-1,4,6-trien-1-ylsulfonylacetate |
|---|---|
| PubChem CID | 123545492 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | ethyl 2-cyclohepta-1,4,6-trien-1-ylsulfonylacetate |
| SMILES | CCOC(=O)CS(=O)(=O)C1=CCC=CC=C1 |
| InChI | InChI=1S/C11H14O4S/c1-2-15-11(12)9-16(13,14)10-7-5-3-4-6-8-10/h3-5,7-8H,2,6,9H2,1H3 |
| InChIKey | PBGGOMIUMRLUBF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |