C20H22O3 — CID 137397198
ethyl 5-(4-cyclohepta-1,4,6-trien-1-ylphenyl)-4-oxopentanoate (PubChem CID 137397198) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is ethyl 5-(4-cyclohepta-1,4,6-trien-1-ylphenyl)-4-oxopentanoate.
| Compound Name | ethyl 5-(4-cyclohepta-1,4,6-trien-1-ylphenyl)-4-oxopentanoate |
|---|---|
| PubChem CID | 137397198 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | ethyl 5-(4-cyclohepta-1,4,6-trien-1-ylphenyl)-4-oxopentanoate |
| SMILES | CCOC(=O)CCC(=O)Cc1ccc(C2=CCC=CC=C2)cc1 |
| InChI | InChI=1S/C20H22O3/c1-2-23-20(22)14-13-19(21)15-16-9-11-18(12-10-16)17-7-5-3-4-6-8-17/h3-5,7-12H,2,6,13-15H2,1H3 |
| InChIKey | DDLBKQAZAJMHSN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |