C30H39N3O7S — CID 123545926
6-amino-5-[[4-carboxy-2-[3-[4-(4-phenylthiophen-2-yl)cyclohex-2-en-1-yl]propanoylamino]butanoyl]amino]-6-hydroxyhexanoic acid (PubChem CID 123545926) has the molecular formula C30H39N3O7S and a molecular weight of 585.72 g/mol. Its IUPAC name is 6-amino-5-[[4-carboxy-2-[3-[4-(4-phenylthiophen-2-yl)cyclohex-2-en-1-yl]propanoylamino]butanoyl]amino]-6-hydroxyhexanoic acid.
| Compound Name | 6-amino-5-[[4-carboxy-2-[3-[4-(4-phenylthiophen-2-yl)cyclohex-2-en-1-yl]propanoylamino]butanoyl]amino]-6-hydroxyhexanoic acid |
|---|---|
| PubChem CID | 123545926 |
| Molecular Formula | C30H39N3O7S |
| Molecular Weight | 585.72 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | 6-amino-5-[[4-carboxy-2-[3-[4-(4-phenylthiophen-2-yl)cyclohex-2-en-1-yl]propanoylamino]butanoyl]amino]-6-hydroxyhexanoic acid |
| SMILES | NC(O)C(CCCC(=O)O)NC(=O)C(CCC(=O)O)NC(=O)CCC1C=CC(c2cc(-c3ccccc3)cs2)CC1 |
| InChI | InChI=1S/C30H39N3O7S/c31-29(39)23(7-4-8-27(35)36)33-30(40)24(14-16-28(37)38)32-26(34)15-11-19-9-12-21(13-10-19)25-17-22(18-41-25)20-5-2-1-3-6-20/h1-3,5-6,9,12,17-19,21,23-24,29,39H,4,7-8,10-11,13-16,31H2,(H,32,34)(H,33,40)(H,35,36)(H,37,38) |
| InChIKey | AGGWSTAMQKIWOC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 179.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.72 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|