C18H23N3O3 — CID 123547157
N-(cyclooctylideneamino)-3-[3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide (PubChem CID 123547157) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-(cyclooctylideneamino)-3-[3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-(cyclooctylideneamino)-3-[3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 123547157 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-(cyclooctylideneamino)-3-[3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide |
| SMILES | O=C(C=Cc1cccc(C(=O)NN=C2CCCCCCC2)c1)NO |
| InChI | InChI=1S/C18H23N3O3/c22-17(21-24)12-11-14-7-6-8-15(13-14)18(23)20-19-16-9-4-2-1-3-5-10-16/h6-8,11-13,24H,1-5,9-10H2,(H,20,23)(H,21,22) |
| InChIKey | XVHNQHYBWBITSX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|