C17H21N3O3 — CID 88862126
N-(cycloheptylideneamino)-3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide (PubChem CID 88862126) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-(cycloheptylideneamino)-3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-(cycloheptylideneamino)-3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 88862126 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-(cycloheptylideneamino)-3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide |
| SMILES | O=C(/C=C/c1cccc(C(=O)NN=C2CCCCCC2)c1)NO |
| InChI | InChI=1S/C17H21N3O3/c21-16(20-23)11-10-13-6-5-7-14(12-13)17(22)19-18-15-8-3-1-2-4-9-15/h5-7,10-12,23H,1-4,8-9H2,(H,19,22)(H,20,21)/b11-10+ |
| InChIKey | LQQYUOYJXRAYFM-ZHACJKMWSA-N |
| XLogP | 2.65 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|