C25H44O5 — CID 123550667
17-(5-hydroxy-5-methoxypentan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7,15-triol (PubChem CID 123550667) has the molecular formula C25H44O5 and a molecular weight of 424.62 g/mol. Its IUPAC name is 17-(5-hydroxy-5-methoxypentan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7,15-triol.
| Compound Name | 17-(5-hydroxy-5-methoxypentan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7,15-triol |
|---|---|
| PubChem CID | 123550667 |
| Molecular Formula | C25H44O5 |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | 17-(5-hydroxy-5-methoxypentan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7,15-triol |
| SMILES | COC(O)CCC(C)C1CC(O)C2C3C(O)CC4CC(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C25H44O5/c1-14(5-6-21(29)30-4)18-13-20(28)23-22-17(8-10-25(18,23)3)24(2)9-7-16(26)11-15(24)12-19(22)27/h14-23,26-29H,5-13H2,1-4H3 |
| InChIKey | MHMZYLXGGSKFRA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|