C11H21N2O2+ — CID 123550744
N-methoxy-N,1-dimethyl-1-azoniabicyclo[2.2.2]octane-3-carboxamide (PubChem CID 123550744) has the molecular formula C11H21N2O2+ and a molecular weight of 213.30 g/mol. Its IUPAC name is N-methoxy-N,1-dimethyl-1-azoniabicyclo[2.2.2]octane-3-carboxamide.
| Compound Name | N-methoxy-N,1-dimethyl-1-azoniabicyclo[2.2.2]octane-3-carboxamide |
|---|---|
| PubChem CID | 123550744 |
| Molecular Formula | C11H21N2O2+ |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | N-methoxy-N,1-dimethyl-1-azoniabicyclo[2.2.2]octane-3-carboxamide |
| SMILES | CON(C)C(=O)C1C[N+]2(C)CCC1CC2 |
| InChI | InChI=1S/C11H21N2O2/c1-12(15-3)11(14)10-8-13(2)6-4-9(10)5-7-13/h9-10H,4-8H2,1-3H3/q+1 |
| InChIKey | SZSJDZOWEWPRQQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|