C25H25FN4O7 — CID 123550915
4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-8-(1H-imidazol-2-yl)-N-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123550915) has the molecular formula C25H25FN4O7 and a molecular weight of 512.49 g/mol. Its IUPAC name is 4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-8-(1H-imidazol-2-yl)-N-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-8-(1H-imidazol-2-yl)-N-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123550915 |
| Molecular Formula | C25H25FN4O7 |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-8-(1H-imidazol-2-yl)-N-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CNC(=O)C1C(=O)C(N(C)C)C2CC3Cc4c(F)c(-c5ncc[nH]5)cc(O)c4C(=O)C3C(=O)C2(O)C1=O |
| InChI | InChI=1S/C25H25FN4O7/c1-27-24(36)16-20(33)18(30(2)3)12-7-9-6-10-15(19(32)14(9)21(34)25(12,37)22(16)35)13(31)8-11(17(10)26)23-28-4-5-29-23/h4-5,8-9,12,14,16,18,31,37H,6-7H2,1-3H3,(H,27,36)(H,28,29) |
| InChIKey | RSSSXJKCOVZXEZ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 169.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|