C24H23FN4O7 — CID 56836816
(4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-8-(1H-imidazol-2-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 56836816) has the molecular formula C24H23FN4O7 and a molecular weight of 498.47 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-8-(1H-imidazol-2-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-8-(1H-imidazol-2-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 56836816 |
| Molecular Formula | C24H23FN4O7 |
| Molecular Weight | 498.47 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-8-(1H-imidazol-2-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cc(-c5ncc[nH]5)c(F)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C24H23FN4O7/c1-29(2)17-11-6-8-5-9-14(12(30)7-10(16(9)25)23-27-3-4-28-23)18(31)13(8)20(33)24(11,36)21(34)15(19(17)32)22(26)35/h3-4,7-8,11,17,30-31,34,36H,5-6H2,1-2H3,(H2,26,35)(H,27,28)/t8-,11-,17-,24-/m0/s1 |
| InChIKey | CJMCBDPSLIACPD-NODDZIHESA-N |
| XLogP | 0.49 |
| TPSA | 190.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.47 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|